![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 16CatherineStreet.pdf | 2013-08-19 09:17 | 1.0M | |
| 2020-03-12-SGSS_medRxiv.pdf | 2020-03-20 10:56 | 2.4M | |
| Bacterial association studies for drug resistance and virulence.pdf | 2016-11-21 18:36 | 16M | |
| ClonalFrameML/ | 2015-03-31 12:12 | - | |
| DTC2015.zip | 2016-12-08 13:13 | 24M | |
| Durbin.pdf | 2017-08-15 21:21 | 4.3M | |
| GWAS and infection.pptx | 2017-04-04 16:39 | 35M | |
| GWASinbacteria.pptx | 2017-02-08 14:21 | 18M | |
| Introductory_Talks | 2015-01-30 13:25 | 13K | |
| Neuroticism_ch12.txt | 2018-12-06 14:02 | 8.0M | |
| Paul/ | 2010-01-18 09:00 | - | |
| Rplots.pdf | 2019-08-19 08:21 | 6.3K | |
| Rplots.png | 2020-12-11 13:18 | 74K | |
| Rplots1.png | 2017-02-06 11:48 | 38K | |
| Rplots3.pdf | 2016-01-26 11:55 | 8.8K | |
| Rplots3.png | 2016-01-26 11:51 | 79K | |
| SMBEJapan2016.pptx | 2016-02-24 06:11 | 17M | |
| Sam/ | 2009-03-21 17:02 | - | |
| Tais/ | 2009-03-24 14:21 | - | |
| Wilson_BDI_talk_v2.pptx | 2017-12-19 16:08 | 8.8M | |
| adaptive.zip | 2010-10-27 19:55 | 19M | |
| adcab/ | 2016-10-17 14:51 | - | |
| bdigwas.pptx | 2017-10-18 09:16 | 29M | |
| blog/ | 2010-10-01 11:45 | - | |
| bricks/ | 2015-08-21 08:02 | - | |
| bugwas_si.pdf | 2016-03-09 16:50 | 18M | |
| cfml.tgz | 2014-08-18 11:33 | 93M | |
| cfmlassistant.css | 2015-11-09 17:29 | 2.2K | |
| cfmlassistant.html | 2015-11-09 17:29 | 13K | |
| checkDavisResnick.png | 2019-08-19 08:20 | 22K | |
| coalescent.R | 2018-11-13 16:20 | 10K | |
| danielwilson.jpg | 2010-02-03 23:26 | 131K | |
| dannyv2.pdf | 2011-02-14 14:48 | 5.4M | |
| dannyv2.pptx | 2011-02-14 14:48 | 6.6M | |
| datasetS1.tar.gz | 2013-11-09 00:07 | 24M | |
| depressive.pHMP.png | 2017-04-20 15:26 | 402K | |
| depressive.png | 2017-04-20 14:50 | 442K | |
| doodles.txt | 2015-01-01 23:50 | 2.5K | |
| dros.hybrid.adaptive.zip | 2010-11-02 14:41 | 36M | |
| dros.hybrid.genewise.zip | 2010-11-02 14:54 | 36M | |
| dros.hybrid.sitewise.zip | 2010-11-02 14:54 | 38M | |
| eczema.pHMP.png | 2017-03-26 11:58 | 169K | |
| eczema.png | 2017-03-23 18:57 | 181K | |
| euprojection.R | 2016-06-29 09:46 | 2.4K | |
| fasta.R | 2018-11-13 16:20 | 4.2K | |
| gemma.djw.tgz | 2017-09-29 17:38 | 52M | |
| genewise.zip | 2010-10-28 08:58 | 20M | |
| gwasBacteria.zip | 2015-03-31 10:35 | 294K | |
| gwasSourceCodes.090215.zip | 2015-02-09 12:01 | 41K | |
| hello.php | 2015-11-08 21:14 | 99 | |
| hmpcorrection-v1.pdf | 2019-07-06 20:24 | 81K | |
| hmpcorrection.pdf | 2019-08-20 15:56 | 103K | |
| info.php | 2015-11-08 21:15 | 20 | |
| mamml.Ecol.odds1.png | 2017-02-03 13:28 | 302K | |
| mamml.Ecol.odds3.png | 2017-02-03 13:35 | 316K | |
| mamml.Ecolbg3.odds1.png | 2017-02-03 13:41 | 311K | |
| mamml.Ecolbg3.odds3.png | 2017-02-03 13:46 | 299K | |
| mamml.Kpne.odds1.png | 2017-02-03 13:53 | 319K | |
| mamml.Kpne.odds3.png | 2017-02-03 13:59 | 335K | |
| mamml.Kpnebg3.odds1.png | 2017-02-03 14:05 | 309K | |
| mamml.Kpnebg3.odds3.png | 2017-02-03 14:12 | 299K | |
| mamml.Mtub.odds1.png | 2017-02-03 13:07 | 354K | |
| mamml.Mtub.odds3.png | 2017-02-03 13:08 | 303K | |
| mamml.Mtubbg2.odds1.png | 2017-02-03 13:08 | 296K | |
| mamml.Mtubbg2.odds3.png | 2017-02-03 13:08 | 266K | |
| mamml.Saur.odds1.png | 2017-02-03 13:10 | 322K | |
| mamml.Saur.odds3.png | 2017-02-03 13:13 | 283K | |
| mamml.Saurbg.odds1.png | 2017-02-13 10:58 | 270K | |
| mamml.Saurbg.odds3.png | 2017-02-13 12:20 | 242K | |
| mamml.Saurbg2.odds1.png | 2017-02-03 13:17 | 239K | |
| mamml.Saurbg2.odds3.png | 2017-02-03 13:22 | 266K | |
| manuscript.zip | 2014-01-29 16:08 | 49M | |
| marketplace/ | 2009-11-30 01:26 | - | |
| movingsalez.jpg | 2010-08-26 17:28 | 412K | |
| neuroticism.pHMP.png | 2017-06-19 11:29 | 249K | |
| neuroticism.png | 2017-06-30 10:22 | 257K | |
| phylogenetics_I.pptx | 2017-11-17 12:54 | 22M | |
| phylogenetics_II.pptx | 2017-11-17 12:54 | 1.0M | |
| pic.tiff | 2014-02-24 09:18 | 1.3M | |
| pics/ | 2009-06-02 21:31 | - | |
| read_dsk/ | 2017-09-29 17:42 | - | |
| selection/ | 2010-04-09 21:56 | - | |
| sitewise.zip | 2010-10-28 08:59 | 21M | |
| slides/ | 2010-12-13 10:23 | - | |
| staph_recombination.-v1.zip | 2013-11-27 15:21 | 9.3M | |
| tlr3selection.jpg | 2009-12-02 19:42 | 302K | |
| vargenes.ppt | 2008-11-18 16:09 | 7.0M | |
| wilson_2019_annotated_corrections.pdf | 2019-07-03 14:06 | 2.2M | |
| wilson_2019_annotated_corrections.v2.pdf | 2019-08-17 15:11 | 2.3M | |